Совокупность реакций органических соединений

Справочная таблица содержит качественные реакции органических соединений, такие как алканы, алкены, бензол, фенол, спирты, амины, альдегиды, карбоновые кислоты и другие вещества.

В ЦТ каждый год присутствуют задания на определения веществ в пронумерованных пробирках или задания с зашифрованными буквами веществами (А, Б, В и т.д.). Для выполнения этих заданий вам необходимо знать качественные реакции на определение веществ.

Качественные реакции органических соединений (Таблица)

Таблица качественные реакции органических соединений

Органическое соединение Реактив (реагент) Качественные реакции органических соединений Запах
Алканы Действие пламя Обычно определяют путем исключения. Низшие алканы горят голубоватым пламенем Есть запах
Алкены С=С
  • 1) Бромная вода
  • 2) Раствор КМnO4
  • 3) Горение
  1. 1) Обесцвечивание раствора
  2. 2) Обесцвечивание раствора, выпадение бурого осадка МnО2↓
  3. 3) Горят слегка желтоватым пламенем (частицы углерода)
Есть запах
Алкины CH=CH
или R-C=CH
Ag2O (NH2 · H2O) Бледно-желтый осадок Ag3O3↓
CuCl (NH3 · H2O) Красный осадок Cu2O2↓
Толуол KMnO4 (раствор)
(кислотный раствор)
Обесцвечивание раствора (при нагревании)
Бензол Горение Качественную реакцию бензола обычно определяют путем исключения. Горит коптящим пламенем Есть запах
Фенол
  • 1) Бромная вода
  • 2) Раствор Na2СО3
  • 3) FeCl3
  1. 1) Обесцвечивание, выпадение бело-желтого осадка трибромфенола
  2. 2) Выделение углекислого газа
  3. 3) Фиолетовое окрашивание
Есть запах
Спирты
  • 1) Na
  • 2) Горение
  • 3) Мерная горячая прокаленная Сu-проволока
  1. 1) Выделение водорода
  2. 2) Горят светлым голубоватым пламенем
  3. 3) Восстановление красной окраски у прокаленной горячей медной проволоки
Есть запах
Многоатомные спирты Сu(ОН)2 + NaOH Синее окрашивание — образование глицератов и другое Нет
Амины 1) Лакмус
2) HHal
1) В водном растворе — синее окрашивание
2) Образуют соли с галогеноводородами — после выпаривания твердый осадок
Есть запах
Анилин 1) Бромная вода
2) HHal
1) Обесцвечивание бромной воды, выпадение осадка триброманилина
2) После упаривания твердый осадок — соль гидрогалогенида анилина
Есть запах
Альдегиды -CHO 1) Аg2О
2) Сu(ОН)2
1) Реакция серебряного зеркала
2) Выпадение красного осадка Сu2O↓
Есть запах
Карбоновые кислоты -COOH 1) Лакмус
2) Na2CO2 (раствор)
1) Красное окрашивание
2) Выделение газа CO2↑
Есть запах
Муравьиная кислота Ag2O (NH2 · H2O) Реакция серебряного зеркала (при нагревании) Есть запах
Олеиновая кислота Br2 (раствор) Обесцвечивание Есть запах
Уксусная кислота Na2CO2 (раствор) Выделение газа CO2↑ , характерный запах уксуса Есть запах
Крахмал Раствор I2 в KI или спиртовой раствор иода При качественной реакции на органическое соединение крахмал происходит синее окрашивание Нет
Белки Конц. HNO3 Желтое окрашивание, при добавлении щелочного раствора — оранжевое Нет
Глюкоза -CHO
  • Cu(OH)2, tº (свежеприготовленный из 2х капель CuSO4 и 1 мл NaOH)
  • 1) Без tº
  • 2) С tº
1) Образование хелата
2) Выпадение красного осадка Cu2O
Нет
Сахароза Cu(OH)2  взвесь Растворение осадка Нет
Cl-производные Cu + пламя Зеленое окрашивание пламени парами CuCl2 Нет
Мыло (стеарат натрия) 1) Лакмус
2) HCl
1) Щелочная среда в результате гидролиза окрашивается в синий цвет
2) Белый осадок ввиде хлопьев стеариновой кислоты
Нет

Качественные реакции органических и неорганических веществ: таблица

Источник: https://infotables.ru/khimiya/913-reaktsii-organicheskikh-soedinenij

Качественные реакции органических и неорганических веществ: таблица

  1. Все нитраты являются растворимыми.
  2. Практически все соли калия, натрия и аммония растворимы.
  3. Все хлориды, бромиды и йодиды растворимы, за исключением галогенидов серебра, ртути (I) и свинца (II).
  4. Все сульфаты растворимы, за исключением сульфатов бария, стронция и свинца (II), которые являются нерастворимыми, и сульфатов кальция и серебра, которые являются умеренно растворимыми.
  5. Все карбонаты, сульфиты и фосфаты не растворяются за исключением карбонатов, сульфитов и фосфатов калия, натрия и аммония.
  6. Все сульфиды нерастворимы, за исключением сульфидов щелочных металлов, щелочноземельных металлов и аммония.
  7. Все гидроксиды нерастворимы за исключением гидроксидов щелочных металлов. Гидроокиси стронция, кальция и бария умеренно растворимы.
Вещество, функциональная группа Реактив Схема реакции Характерные признаки
Непредельные углеводороды (алкены, алкины, диены), кратные связи р-р KMnO4 (розовый) СН2=СН2 + Н2О + КMnO4 → КОН + MnO2↓+ СН2(ОН)-СН2(ОН) обесцвечивание р-ра
р-р I2 (бурый) СН2=СН-CН3 + I2 → СН2(I)-СН(I)-CH3 обесцвечивание р-ра
р-р Br2 (желтый) СН2=СН2 + Br2 → СН2(Br)-СН2(Br) обесцвечивание р-ра
Ацетилен аммиачный р-р Ag2O CH ≡ СН + [Ag(NH3)2]OH → AgC≡CAg↓ + NH3↑ + H2O образование осадка (ацетиленид серебра) белого цвета (взрывоопасен)
Бензол нитрующая смесь HNO3 + H2SO4 t0C, H2SO4(конц.) C6Н6 + HNO3 → C6H5-NO2 + H2O образование тяжелой жидкости светло-желтого цвета с запахом горького миндаля
Толуол р-р KMnO4 (розовый) C6Н5-СН3 + KMnO4 + H2SO4 → C6Н5-COOH + H2O + K2SO4 + MnSO4 обесцвечивание р-ра
Фенол (карболовая кислота) р-р FeCl3 (светло-желтый) C6Н5OH + FeCl3 → (C6Н5O)3Fe + HCl окрашивание р-ра в фиолетовый цвет
насыщенный р-р Br2(бромная вода) C6Н5OH + 2Br2 → C6Н2Br3OH↓ + HBr образование белого осадка со специфическим запахом
Анилин (аминобензол) р-р хлорной извести CaOCl2 (бесцветный) окрашивание р-ра в фиолетовый цвет
Этанол насыщенный р-р I2 + р-р NaOH C2H5OH + I2 + NaOH → CHI3↓ + HCOONa + NaI + H2O образование мелкокристаллического осадка СНI3 светло-желтого цвета со специфическим запахом
CuO (прокаленная медная проволока) C2H5OH + CuO → Cu↓ + CH3-CHO + H2O выделение металлической меди, специфический запах ацетальдегида
Гидроксогруппа (спирты, фенол, гидроксикислоты) Металлический Na R-OH + Na → R-O-Na+ + H2↑ C6H5-OH + Na → C6H5-O-Na+ + H2↑ выделение пузырьков газа (Н2), образование бесцветной студенистой массы
Эфиры (простые и сложные) Н2О (гидролиз) в присутствии NaOH при нагревании CH3-C(O)-O-C2H5 + H2O ↔ CH3COOH + C2H5OH специфический запах
Многоатомные спирты, глюкоза Свежеосажденный гидроксид меди (II) в сильно щелочной среде ярко-синее окрашивание р-ра
Карбонильная группа – СНО (альдегиды, глюкоза) Аммиачный р-р Ag2O R-CHO + [Ag(NH3)2]OH → R-COOH + Ag↓ + NH3↑ + H2O образование блестящего налета Ag («серебряное зеркало») на стенках сосудов
Свежеосажденный Сu(OH)2 R-CHO + Cu(OH)2 → R-COOH + Cu2O↓ + H2O образование красного осадка Сu2O
Карбоновые кислоты лакмус окрашивание р-ра в розовый цвет
р-р Na2CO3 R-COOH + Na2CO3 → R-COO-Na+ + H2O + CO2↑ выделение СО2
спирт +H2SO4(конц.) R-COOH + HO-R1 ↔ RC(O)OR1 + H2O специфический запах образующегося сложного эфира
Муравьиная кислота Свежеосажденный Сu(OH)2 HCOOH + Cu(OH)2 → Cu2O↓ + H2O + CO2↑ образование красного осадка Сu2O
Аммиачный р-р Ag2O HCOOH + [Ag(NH3)2]OH → Ag↓ + H2O + CO2↑ «серебряное зеркало» на стенках сосуда
Олеиновая кислота р-р KMnO4 (розовый) или I2 (бурый) или Br2(желтый) C17H33COOH + KMnO4 + H2O → C8H17-CH(OH)-CH(OH)-(CH2)7-COOH + MnO2↓ + KOH C17H33COOH + I2 → C8H17-CH(I)-CH(I)-(CH2)7-COOH обесцвечивание р-ра
Ацетаты (соли уксусной кислоты) р-р FeCl3 CH3COONa + FeCl3 → (CH3COO)3Fe + NaCl окрашивание р-ра в красно-бурый цвет
Стеарат натрия (мыло) Н2О (гидролиз) + фенолфталеин C17H35COONa + H2O ↔ C17H35OOH↓ + NaOH окрашивание р-ра в малиновый цвет
насыщенный р-р соли кальция C17H35COONa + Ca2+ ↔ (C17H35COO)2Ca↓ + Na+ образование серого осадка
Концентрированная неорганическая кислота C17H35COONa + H+ ↔ C17H355COOH↓ + Na+ образование белого осадка
Белок пламя реакция горения запах «паленого», жженых перьев
НNO3 (конц.);t, °С ксантопротеиновая реакция (происходит нитрование бензольных колец в молекуле белка)
  • без нагревания – появляется желтое окрашивание р-ра;
  • при нагревании и добавлении раствора аммиака белок окрашивается в желтый цвет
Свежеосажденный Сu(OH)2 биуретовая реакция (образуется комплексное соединение) сине-фиолетовое окрашивание р-ра
Читайте также:  Как написать электронные формулы атомов?

Качественные реакции неорганических веществ на катионы, анионы, для газов и для щелочных металлов

Качественные реакции на катионы

Катион Реактив Реакция Характерные признаки
Н+ Лакмус Метилоранж Красное окрашивание Розовое окрашивание
Ва2+ Растворимые сульфаты, серная кислота. Пламя спиртовки. Ba2+ + SO42- = BaSO4↓ Белый мелкодисперсный осадок BaSO4, нерастворимый в H2O и HNO3. Желто-зеленая окраска пламени.
Ag+ Растворимые хлориды, соляная кислота Ag+ + Cl- = AgCl↓ Белый творожистый осадок AgCl, нерастворимый в H2O и HNO3
NH4+ Раствор щелочи, нагревание, влажная фильтровальная бумажка, пропитанная лакмусом или фенолфталеином; палочка, смоченная HCl(конц) NH4+ + OH- = NH4OH (NH3↑ + HO2) NH3 + HCl = NH4Cl Специфический запах аммиака. Изменение окраски бумажки. Палочка, смоченная HCl(конц) «дымит»
Al3+ Растворы щелочи, кислоты Al3+ + 3OH- = Al(OH)3↓ Al(OH)3 + 3H+ = Al3+ + 3H2O Al(OH)3 + OH- = [Al(OH)4]- Белый осадок Al(OH)3, растворимый в кислоте в избытке щелочи
Zn2+ Растворы щелочи, кислоты Zn2+ + 2OH- = Zn(OH)2↓ Zn(OH)2 + 2H+ = Zn2+ + 2H2O Zn(OH)2 + 2OH- = [Zn(OH)4]2- Белый осадок Zn(OH)2, растворимый в кислоте в избытке щелочи
Mg2+ Раствор щелочи Mg2+ + 2OH- = Mg(OH)2↓ Белый осадок Mg(OH)2, нерастворимый в избытке щелочи
Cr3+ Растворы щелочи, кислоты Cr3+ + 3OH- = Cr(OH)3↓ Cr(OH)3 + 3H+ = Cr3+ + 3H2O Cr(OH)3 + OH- = [Cr(OH)4]- Cеро-зеленый осадок Cr(OH)3, растворимый в кислоте в избытке щелочи
Fe2+ Раствор красной кровяной соли K3[Fe(CN)6] 3Fe2++2[Fe(CN)6]3- = Fe3[Fe(CN)6]2↓ Образование турнбулевой сини Fe3[Fe(CN)6]2
Fe3+ Раствор роданида аммония NH4CNS Раствор желтой кровяной соли K4[Fe(CN)6] Fe3+ + 3CNS- = Fe(CNS)3 4Fe3+ + 3[Fe(CN)6]4+ = Fe4[Fe(CN)6]3↓ Кроваво-красное окрашивание раствора Образование берлинской лазури Fe4[Fe(CN)6]3
Cu2+ Раствор щелочи с последующим нагреванием Cu2+ + 2OH- = Cu(OH)2↓ Cu(OH)2 → CuO + H2O Ярко-голубой студенистый осадок, нерастворимый в избытке щелочи, разлагающийся при нагревании на черный осадок CuO и воду

Качественные реакции на анионы

OH- Лакмус Синее окрашивание
Фенолфталеин Малиновое окрашивание
Метилоранж Желтое окрашивание
Cl- Раствор нитрата серебра AgNO3 Ag+ + Cl- = AgCl↓ Белый творожистый осадок, нерастворимый в H2O и HNO3
Br- Раствор нитрата серебра AgNO3 Ag+ + Br- = AgBr↓ Светло-желтый осадок, нерастворимый в H2O и HNO3
I- Раствор нитрата серебра AgNO3 Ag+ + I- = AgI↓ Желтый осадок, нерастворимый в H2O и HNO3
NO3- Концентрированная серная кислота и медная стружка при нагревании H2SO4+ 2NH4NO3=(NH4)2SO4 + 2HNO3 4HNO3+Cu → Cu(NO3)2+2NO2 +2H2O Бурый газ (NO2), голубая окраска раствора
SO42- Раствор соли бария Ba2+ + SO42- = BaSO4↓ Белый мелкодисперсный осадок, нерастворимый в H2O и HNO3
SO32- Сильная кислота 2H+ + SO32- = H2SO3 (SO2↑ +H2O) Газ с резким специфическим запахом
S2- Раствор соли свинца Pb2+ + S2- = PbS↓ Черно-бурый осадок
CO32- Cильная кислота 2H+ + CO32- = H2CO3 (CO2↑+ H2O) Газ без цвета и запаха, не поддерживает горение
HCO3- H+ + HCO3- = H2O + CO2↑
PO43- Раствор нитрата серебра в слабощелочной среде 3Ag+ + PO43- = Ag3PO4↓ Желтый осадок, растворимый в HNO3
HPO43- 3Ag+ + HPO42- = Ag3PO4↓ +H+
H2PO4 — 3Ag+ + H2PO4- = Ag3PO4 +2H+

Качественные реакции для газов

Вещество Реактив Реакция Характерные признаки
Н2 О2 (сжигание) 2Н2 + О2 = 2Н2О Запотевание холодного предмета
О2 С (тлеющая лучинка) С + О2 = СО2 Вспышка
Сl2 Бумажка, пропитанная крахмальным клейстером и раствором иодида калия 2KI + Cl2 = 2KCl + I2↓ Посинение бумажки
I2 Крахмальный клейстер Синее окрашивание
СО2 Известковая вода Са(ОН)2 + СО2 = СаСО3↓+ Н2О Помутнение раствора
NH3 Хлороводород NH3 + HCl = NH4Cl Белый дым. Специфический запах NH3, образование белого дыма (NH4Cl)

Качественные реакции для щелочных металлов

Все соединения щелочных металлов определяют по цвету пламени:

Ba2+ K+ Са2+ Li+ Na+ Sr2+
желто-зеленое фиолетовое кирпично-красное ярко-красное желтое карминово-красное

Источник: https://bingoschool.ru/blog/24/

Качественные реакции на НЕОРГАНИЧЕСКИЕ вещества

КАЧЕСТВЕННЫЕ РЕАКЦИИ НА КАТИОНЫ

Читайте также:  Как запомнить формулы приведения?
Катион Воздействие или реактив Наблюдаемая реакция
  Li+ Пламя Карминово-красное окрашивание (ближе к малиновому)
  Na+ Пламя Желтое окрашивание
К+ Пламя Фиолетовое окрашивание
Са2+ Пламя Кирпично-красное окрашивание
Sr2+ Пламя Карминово-красное окрашивание
Ва2+ Пламя
S042-
Желто-зеленое окрашивание
Выпадение белого осадка, не раствори­мого в кислотах: Ва2+ + S042- BaS04
Сu2+ Вода Гидратированные (окружённые водой) ионы Сu2+ имеют голубую окраску
РЬ2+ S2- Выпадение черного осадка: Pb2+ + S2- PbS
Аg+ Cl— Выпадение белого осадка; не раствори­мого в HNO3, но растворимого в конц.
NH3 • Н20:
Аg+ +Cl—AgCl
Fe2+ гексациано-феррат (III) калия (красная кровяная соль) ,K3[Fe(CN)6] Выпадение синего осадка:
К++ Fe2+ + [Fe(CN)6]3- KFe[Fe(CN)6]4
Fe3+ 1)  гексацианоферрат (II) калия (желтая
кровяная соль)
K4[Fe(CN)6]
2)   роданид-ион
SCN—
Выпадение синего осадка:
К+ + Fe3+ + [Fe(CN)6]4-  KFe[Fe(CN)6]
Появление ярко-красного окрашивания за счет образования комплексных ионов Fe(SCN)2+, Fe(SCN)+2
Al3+ щелочь (амфотерные свойства гидроксида) Выпадение осадка гидроксида алюминия при приливании первых порций щелочи и его растворение при дальнейшем приливании
NH4+ щелочь, нагрев Запах аммиака: NH4+ + ОН— NH3 + Н20
Н+
(кислая среда)
Индикаторы: лакмус, метиловый оранжевый красное окрашивание
красное окрашивание

КАЧЕСТВЕННЫЕ РЕАКЦИИ НА АНИОНЫ

Анион
Реактив

Наблюдаемая реакция
S042- Ва2+ Выпадение белого осадка, нерастворимого в кислотах:
Ва2+ + S042- BaS04
N03— 1) добавить конц. H2SO4 и Си, нагреть «2) смесь
H2S04 +FeSO4
Образование голубого раствора, содержащего ионы Сu2+, выделение газа бурого цвета (NO2)
Возникновение окраски сульфата нитрозо-железа (II) [Fe(H20)5NO]2+. Окраска от фи­олетовой до коричневой (реакция «бурого кольца»)
РО43- ионы Ag+ Выпадение светло-желтого осадка в нейтральной среде: ЗАg+ + Р043- Аg3Р04
СrO42- ионы Ва2+ Выпадоние желтого осадка, не раствори­мого в уксусной кислоте, но растворимого в HCI: Ва2+ + СrO42- BaCr04
S2-  , ионы РЬ2+ Выпадение черного осадка: Pb2+ + S2- PbS
СО32- ионы Са2+ выпадение белого осадка, растворимого в
кислотах: Са2+ + С032- = СаСОз
CO2 известковая вода Са(ОН)2 Са(ОН)2 + С02 СаСО3 + Н20, СаСО3 + С02 + Н20 Са(НС03)2 Выпадение белого осадка и его растворение при пропускании С02
SO32- ионы Н+ Появление характерного запаха S02: 2Н+ + SO32- Н20 + S02f
F— ионы Са2+ Выпадение-белого осадка: Са2+ + 2F- CaF2
Cl— ионы Аg+ Выпадение белого осадка, не растворимо­го в HN03, но растворимого в конц. NH3 • Н20: Аg+ +CI— AgCl
AgCI + 2(NH3• Н20) [Ag(NH3)2]+ + CI— + 2Н2О
Br— ионы Аg+ Выпадение светло-желтого осадка, не растворимого в HN03: Ag+ + Br— = AgBr осадок темнеет на свету
I— ионы Аg+ Выпадение желтого осадка, не раствори­мого в HNO3 и NH3 конц.: Аg+ + I— АgI осадок темнеет на свету
ОН— (щелочная среда) индикаторы: лакмус
фенолфталеин
синее окрашивание малиновое окрашивание

Таблица качественных реакций по цвету осадка

Осадки белого цвета Качественная реакция
Белый творожистый:

  • нерастворимый в воде;
  • нерастворимый в HNO3
  1. Ag+ + Cl— → AgCl↓
  2. качественная реакция на соли серебра;
  3. качественная реакция на хлорид-ионы;
Белый осадок:

  • нерастворимый в кислотах.
  • Ba2+ + SO4 -2 → BaSO4↓
  • качественная реакция на соли бария;
  • качественная реакция на сульфат-ионы;
Белый осадок:

  1. образуется при пропускании газа без цвета с резким запахом через известковую воду;
  2. растворяется при пропускании избытка газа;
  3. растворяется в кислотах.
Сa(OH)2 + SO2 = CaSO3↓ + H2O

  • избыток SO2: CaSO3↓ + H2O + SO2 = Ca(HSO3)2;
  • растворение в кислотах:
    CaSO3 + 2H+ → SO2↑ + H2O + Ca2+
Белый осадок:

  • образуется при добавлении щелочи;
  • растворяется в избытке щелочи.
Al3+ + 3OH— = Al(OH)3↓
Zn2+ + 2OH— = Zn(OH)2↓

  • избыток щелочи: Al(OH)3 + 3NaOH =Na3[Al(OH)6];
  • избыток щелочи: Zn(OH)2 +2NaOH =Na2[Zn(OH)]4;
Белый осадок:

  1. образуется при пропускании газа без цвета и запаха через известковую воду;
  2. растворяется при пропускании избытка газа;
  3. растворяется в кислотах.
Сa(OH)2 + CO2 = CaCO3↓ + H2O

  • избыток CO2: CaCO3↓ + H2O + CO2 = Ca(HSO3)2;
  • растворение в кислотах:

CaCO3 + 2H+ → CO2↑ + H2O + Ca2+

Осадок светло-желтого цвета:

  • (осадок кремового цвета);
  • образуется при приливании AgNO3;
  • нерастворим в HNO3.
  1. Ag+ + Br— → AgBr↓
  2. качественная реакция на бромид-ионы;
  3. (качественная реакция на соли серебра);
Осадок желтого цвета:

  • образуется при приливании AgNO3;
  • нерастворим в HNO3.
  1. Ag+ + I— → AgJ↓
  2. качественная реакция на иодид-ионы;
  3. (качественная реакция на соли серебра);
Осадок желтого цвета:

  • образуется при приливании AgNO3;
  • растворим в кислотах.
3Ag+ + PO43- → Ag3PO4↓
Осадки коричневых цветов Качественная реакция
Осадок бурого цвета:

  • образуется при взаимодействии с растворами щелочей.
Fe3+ +3OH— → Fe(OH)3↓
качественная реакция на соли железа
Осадки синих цветов Качественная реакция
Осадок голубого цвета:

  • образуется при взаимодействии с растворами щелочей.
Cu2+ +2OH— → Cu(OH)2↓
качественная реакция на соли меди (II)
Осадок синего цвета:

  • образуется при взаимодействии с раствором красной кровяной и желтой кровяной соли.
  • 3Fe2+ + 2[Fe(CN)6]3- → Fe3[Fe(CN)6]2↓
  • качественная реакция на соли железа (II) — с красной кровяной солью;
  • 4Fe3+ + 3[Fe(CN)6]4-4 → Fe4[Fe(CN)6]3↓
  • качественная реакция на соли железа (III) — с желтой кровяной солью;
Осадки черного цвета Качественная реакция
Осадок черного цвета:

  • Образуется при взаимодействии с сульфидами или с H2S.
  1. Fe2+ + S2- → FeS↓
  2. Ni2+ + S2- → NiS↓
  3. Cu2+ + S2- → CuS↓
  4. Pb2+ + S2- → PbS↓
  5. Hg2+ + S2- → HgS↓
  6. Ag+ + S2- → Ag2S↓
  7. качественная реакция на сульфид-ионы

Источник: http://www.yoursystemeducation.com/kachestvennye-reakcii-na-neorganicheskie-veshhestva/

Ссылка на основную публикацию
Adblock
detector